C17H25BrO2 — CID 143217033
methyl (5Z,8Z,11Z,14Z)-16-bromohexadeca-5,8,11,14-tetraenoate (PubChem CID 143217033) has the molecular formula C17H25BrO2 and a molecular weight of 341.29 g/mol. Its IUPAC name is methyl (5Z,8Z,11Z,14Z)-16-bromohexadeca-5,8,11,14-tetraenoate.
| Compound Name | methyl (5Z,8Z,11Z,14Z)-16-bromohexadeca-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 143217033 |
| Molecular Formula | C17H25BrO2 |
| Molecular Weight | 341.29 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | methyl (5Z,8Z,11Z,14Z)-16-bromohexadeca-5,8,11,14-tetraenoate |
| SMILES | COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CBr |
| InChI | InChI=1S/C17H25BrO2/c1-20-17(19)15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18/h2-3,6-9,12,14H,4-5,10-11,13,15-16H2,1H3/b3-2-,8-6-,9-7-,14-12- |
| InChIKey | HGLUICZUNUJXKP-BZUXQQDJSA-N |
| XLogP | 5.12 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.29 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|