C21H33FO2 — CID 10449696
methyl (5Z,8Z,11Z,14Z)-20-fluoroicosa-5,8,11,14-tetraenoate (PubChem CID 10449696) has the molecular formula C21H33FO2 and a molecular weight of 336.49 g/mol. Its IUPAC name is methyl (5Z,8Z,11Z,14Z)-20-fluoroicosa-5,8,11,14-tetraenoate.
| Compound Name | methyl (5Z,8Z,11Z,14Z)-20-fluoroicosa-5,8,11,14-tetraenoate |
|---|---|
| PubChem CID | 10449696 |
| Molecular Formula | C21H33FO2 |
| Molecular Weight | 336.49 g/mol |
| Exact Mass | 336.25 |
| IUPAC Name | methyl (5Z,8Z,11Z,14Z)-20-fluoroicosa-5,8,11,14-tetraenoate |
| SMILES | COC(=O)CCC/C=C\C/C=C\C/C=C\C/C=C\CCCCCF |
| InChI | InChI=1S/C21H33FO2/c1-24-21(23)19-17-15-13-11-9-7-5-3-2-4-6-8-10-12-14-16-18-20-22/h2,4-5,7-8,10-11,13H,3,6,9,12,14-20H2,1H3/b4-2-,7-5-,10-8-,13-11- |
| InChIKey | REKKSTDVIZCJAG-WGBGRZMPSA-N |
| XLogP | 6.25 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.49 |
| LogP ≤ 5 | 6.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|