C16H26O3 — CID 66558829
methyl (6Z,9Z,12Z)-15-hydroxypentadeca-6,9,12-trienoate (PubChem CID 66558829) has the molecular formula C16H26O3 and a molecular weight of 266.38 g/mol. Its IUPAC name is methyl (6Z,9Z,12Z)-15-hydroxypentadeca-6,9,12-trienoate.
| Compound Name | methyl (6Z,9Z,12Z)-15-hydroxypentadeca-6,9,12-trienoate |
|---|---|
| PubChem CID | 66558829 |
| Molecular Formula | C16H26O3 |
| Molecular Weight | 266.38 g/mol |
| Exact Mass | 266.19 |
| IUPAC Name | methyl (6Z,9Z,12Z)-15-hydroxypentadeca-6,9,12-trienoate |
| SMILES | COC(=O)CCCC/C=C\C/C=C\C/C=C\CCO |
| InChI | InChI=1S/C16H26O3/c1-19-16(18)14-12-10-8-6-4-2-3-5-7-9-11-13-15-17/h3-6,9,11,17H,2,7-8,10,12-15H2,1H3/b5-3-,6-4-,11-9- |
| InChIKey | VLJCKWZSFZRQOD-XHZZGSEBSA-N |
| XLogP | 3.55 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.38 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|