C28H35F3O5 — CID 10649314
[(1S)-1-[(2S,4Z,7Z,10Z)-16-oxo-1-oxacyclohexadeca-4,7,10-trien-2-yl]propyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10649314) has the molecular formula C28H35F3O5 and a molecular weight of 508.58 g/mol. Its IUPAC name is [(1S)-1-[(2S,4Z,7Z,10Z)-16-oxo-1-oxacyclohexadeca-4,7,10-trien-2-yl]propyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S)-1-[(2S,4Z,7Z,10Z)-16-oxo-1-oxacyclohexadeca-4,7,10-trien-2-yl]propyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10649314 |
| Molecular Formula | C28H35F3O5 |
| Molecular Weight | 508.58 g/mol |
| Exact Mass | 508.24 |
| IUPAC Name | [(1S)-1-[(2S,4Z,7Z,10Z)-16-oxo-1-oxacyclohexadeca-4,7,10-trien-2-yl]propyl] (2S)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | CC[C@H](OC(=O)[C@@](OC)(c1ccccc1)C(F)(F)F)[C@@H]1C/C=C\C/C=C\C/C=C\CCCCC(=O)O1 |
| InChI | InChI=1S/C28H35F3O5/c1-3-23(36-26(33)27(34-2,28(29,30)31)22-18-14-13-15-19-22)24-20-16-11-9-7-5-4-6-8-10-12-17-21-25(32)35-24/h5-8,11,13-16,18-19,23-24H,3-4,9-10,12,17,20-21H2,1-2H3/b7-5-,8-6-,16-11-/t23-,24-,27-/m0/s1 |
| InChIKey | GMUVXLBLTRWJCT-XEXSLXAVSA-N |
| XLogP | 6.74 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.58 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|