C22H33F3O3Si — CID 10598746
(2S)-3,3,3-trifluoro-2-methoxy-2-phenyl-1-[2-[(1S)-1-trimethylsilyloxypropyl]cyclohexyl]propan-1-one (PubChem CID 10598746) has the molecular formula C22H33F3O3Si and a molecular weight of 430.58 g/mol. Its IUPAC name is (2S)-3,3,3-trifluoro-2-methoxy-2-phenyl-1-[2-[(1S)-1-trimethylsilyloxypropyl]cyclohexyl]propan-1-one.
| Compound Name | (2S)-3,3,3-trifluoro-2-methoxy-2-phenyl-1-[2-[(1S)-1-trimethylsilyloxypropyl]cyclohexyl]propan-1-one |
|---|---|
| PubChem CID | 10598746 |
| Molecular Formula | C22H33F3O3Si |
| Molecular Weight | 430.58 g/mol |
| Exact Mass | 430.22 |
| IUPAC Name | (2S)-3,3,3-trifluoro-2-methoxy-2-phenyl-1-[2-[(1S)-1-trimethylsilyloxypropyl]cyclohexyl]propan-1-one |
| SMILES | CC[C@H](O[Si](C)(C)C)C1CCCCC1C(=O)[C@@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C22H33F3O3Si/c1-6-19(28-29(3,4)5)17-14-10-11-15-18(17)20(26)21(27-2,22(23,24)25)16-12-8-7-9-13-16/h7-9,12-13,17-19H,6,10-11,14-15H2,1-5H3/t17?,18?,19-,21-/m0/s1 |
| InChIKey | MXAZCLRLRRICJH-XSNSTOHYSA-N |
| XLogP | 6.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.58 |
| LogP ≤ 5 | 6.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|