C15H15F3O3 — CID 10447502
[(1S)-2-methylidenecyclopropyl]methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate (PubChem CID 10447502) has the molecular formula C15H15F3O3 and a molecular weight of 300.28 g/mol. Its IUPAC name is [(1S)-2-methylidenecyclopropyl]methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate.
| Compound Name | [(1S)-2-methylidenecyclopropyl]methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 10447502 |
| Molecular Formula | C15H15F3O3 |
| Molecular Weight | 300.28 g/mol |
| Exact Mass | 300.10 |
| IUPAC Name | [(1S)-2-methylidenecyclopropyl]methyl 3,3,3-trifluoro-2-methoxy-2-phenylpropanoate |
| SMILES | C=C1C[C@@H]1COC(=O)C(OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C15H15F3O3/c1-10-8-11(10)9-21-13(19)14(20-2,15(16,17)18)12-6-4-3-5-7-12/h3-7,11H,1,8-9H2,2H3/t11-,14?/m1/s1 |
| InChIKey | MJGVLEGPLABRED-YNODCEANSA-N |
| XLogP | 3.21 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.28 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|