C20H26F3NO6 — CID 10836532
methyl (3S)-5-(butylamino)-5-oxo-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypentanoate (PubChem CID 10836532) has the molecular formula C20H26F3NO6 and a molecular weight of 433.42 g/mol. Its IUPAC name is methyl (3S)-5-(butylamino)-5-oxo-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypentanoate.
| Compound Name | methyl (3S)-5-(butylamino)-5-oxo-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypentanoate |
|---|---|
| PubChem CID | 10836532 |
| Molecular Formula | C20H26F3NO6 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | methyl (3S)-5-(butylamino)-5-oxo-3-[(2R)-3,3,3-trifluoro-2-methoxy-2-phenylpropanoyl]oxypentanoate |
| SMILES | CCCCNC(=O)C[C@@H](CC(=O)OC)OC(=O)[C@](OC)(c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C20H26F3NO6/c1-4-5-11-24-16(25)12-15(13-17(26)28-2)30-18(27)19(29-3,20(21,22)23)14-9-7-6-8-10-14/h6-10,15H,4-5,11-13H2,1-3H3,(H,24,25)/t15-,19+/m0/s1 |
| InChIKey | SNGVXGXPNLDXID-HNAYVOBHSA-N |
| XLogP | 2.87 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|