C22H32O6 — CID 70624812
methyl 7-[4-hydroxy-6-methoxy-2-(phenylmethoxymethyl)oxan-3-yl]hept-6-enoate (PubChem CID 70624812) has the molecular formula C22H32O6 and a molecular weight of 392.49 g/mol. Its IUPAC name is methyl 7-[4-hydroxy-6-methoxy-2-(phenylmethoxymethyl)oxan-3-yl]hept-6-enoate.
| Compound Name | methyl 7-[4-hydroxy-6-methoxy-2-(phenylmethoxymethyl)oxan-3-yl]hept-6-enoate |
|---|---|
| PubChem CID | 70624812 |
| Molecular Formula | C22H32O6 |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.22 |
| IUPAC Name | methyl 7-[4-hydroxy-6-methoxy-2-(phenylmethoxymethyl)oxan-3-yl]hept-6-enoate |
| SMILES | COC(=O)CCCCC=CC1C(O)CC(OC)OC1COCc1ccccc1 |
| InChI | InChI=1S/C22H32O6/c1-25-21(24)13-9-4-3-8-12-18-19(23)14-22(26-2)28-20(18)16-27-15-17-10-6-5-7-11-17/h5-8,10-12,18-20,22-23H,3-4,9,13-16H2,1-2H3 |
| InChIKey | WBWLSYPHROTIFN-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|