C33H40O7 — CID 135000890
methyl (4R)-4-[4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypentanoate (PubChem CID 135000890) has the molecular formula C33H40O7 and a molecular weight of 548.68 g/mol. Its IUPAC name is methyl (4R)-4-[4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypentanoate.
| Compound Name | methyl (4R)-4-[4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypentanoate |
|---|---|
| PubChem CID | 135000890 |
| Molecular Formula | C33H40O7 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | methyl (4R)-4-[4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]oxypentanoate |
| SMILES | COC(=O)CC[C@@H](C)OC1CC(OCc2ccccc2)C(OCc2ccccc2)C(COCc2ccccc2)O1 |
| InChI | InChI=1S/C33H40O7/c1-25(18-19-31(34)35-2)39-32-20-29(37-22-27-14-8-4-9-15-27)33(38-23-28-16-10-5-11-17-28)30(40-32)24-36-21-26-12-6-3-7-13-26/h3-17,25,29-30,32-33H,18-24H2,1-2H3/t25-,29?,30?,32?,33?/m1/s1 |
| InChIKey | AFYXYEULCNENOB-XAFAKUIVSA-N |
| XLogP | 5.85 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 5.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |