C34H42O4 — CID 134969243
(3S,4R,6R)-6-[(E,2S)-5-methylhex-3-en-2-yl]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane (PubChem CID 134969243) has the molecular formula C34H42O4 and a molecular weight of 514.71 g/mol. Its IUPAC name is (3S,4R,6R)-6-[(E,2S)-5-methylhex-3-en-2-yl]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane.
| Compound Name | (3S,4R,6R)-6-[(E,2S)-5-methylhex-3-en-2-yl]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane |
|---|---|
| PubChem CID | 134969243 |
| Molecular Formula | C34H42O4 |
| Molecular Weight | 514.71 g/mol |
| Exact Mass | 514.31 |
| IUPAC Name | (3S,4R,6R)-6-[(E,2S)-5-methylhex-3-en-2-yl]-3,4-bis(phenylmethoxy)-2-(phenylmethoxymethyl)oxane |
| SMILES | CC(C)/C=C/[C@H](C)[C@H]1C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)C(COCc2ccccc2)O1 |
| InChI | InChI=1S/C34H42O4/c1-26(2)19-20-27(3)31-21-32(36-23-29-15-9-5-10-16-29)34(37-24-30-17-11-6-12-18-30)33(38-31)25-35-22-28-13-7-4-8-14-28/h4-20,26-27,31-34H,21-25H2,1-3H3/b20-19+/t27-,31+,32+,33?,34-/m0/s1 |
| InChIKey | VCAZRSAGZYEUDD-QUKWOEQWSA-N |
| XLogP | 7.38 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.71 |
| LogP ≤ 5 | 7.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|