C45H44BrO4P — CID 134978334
[(4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-bromo-triphenyl-λ5-phosphane (PubChem CID 134978334) has the molecular formula C45H44BrO4P and a molecular weight of 759.72 g/mol. Its IUPAC name is [(4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-bromo-triphenyl-λ5-phosphane.
| Compound Name | [(4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-bromo-triphenyl-λ5-phosphane |
|---|---|
| PubChem CID | 134978334 |
| Molecular Formula | C45H44BrO4P |
| Molecular Weight | 759.72 g/mol |
| Exact Mass | 758.22 |
| IUPAC Name | [(4R,5S,6R)-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]-bromo-triphenyl-λ5-phosphane |
| SMILES | BrP(c1ccccc1)(c1ccccc1)(c1ccccc1)C1C[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H](COCc2ccccc2)O1 |
| InChI | InChI=1S/C45H44BrO4P/c46-51(39-25-13-4-14-26-39,40-27-15-5-16-28-40,41-29-17-6-18-30-41)44-31-42(48-33-37-21-9-2-10-22-37)45(49-34-38-23-11-3-12-24-38)43(50-44)35-47-32-36-19-7-1-8-20-36/h1-30,42-45H,31-35H2/t42-,43-,44?,45+/m1/s1 |
| InChIKey | DWXDLOHJFLANRG-JJNJNQDBSA-N |
| XLogP | 9.33 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.72 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|