C37H42O7 — CID 155768067
1-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propane-1,2-diol (PubChem CID 155768067) has the molecular formula C37H42O7 and a molecular weight of 598.74 g/mol. Its IUPAC name is 1-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propane-1,2-diol.
| Compound Name | 1-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propane-1,2-diol |
|---|---|
| PubChem CID | 155768067 |
| Molecular Formula | C37H42O7 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.29 |
| IUPAC Name | 1-[(2R,3S,4S,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]propane-1,2-diol |
| SMILES | CC(O)C(O)[C@H]1O[C@H](COCc2ccccc2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C37H42O7/c1-27(38)33(39)35-37(43-25-31-20-12-5-13-21-31)36(42-24-30-18-10-4-11-19-30)34(41-23-29-16-8-3-9-17-29)32(44-35)26-40-22-28-14-6-2-7-15-28/h2-21,27,32-39H,22-26H2,1H3/t27?,32-,33?,34-,35-,36+,37-/m1/s1 |
| InChIKey | FRFUUYUJFXCXBC-KARHRLJASA-N |
| XLogP | 5.47 |
| TPSA | 86.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |