C19H28O2 — CID 23729971
(2S,3S)-2-[(Z)-non-1-enyl]-3-(phenylmethoxymethyl)oxirane (PubChem CID 23729971) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (2S,3S)-2-[(Z)-non-1-enyl]-3-(phenylmethoxymethyl)oxirane.
| Compound Name | (2S,3S)-2-[(Z)-non-1-enyl]-3-(phenylmethoxymethyl)oxirane |
|---|---|
| PubChem CID | 23729971 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (2S,3S)-2-[(Z)-non-1-enyl]-3-(phenylmethoxymethyl)oxirane |
| SMILES | CCCCCCC/C=C\[C@@H]1O[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C19H28O2/c1-2-3-4-5-6-7-11-14-18-19(21-18)16-20-15-17-12-9-8-10-13-17/h8-14,18-19H,2-7,15-16H2,1H3/b14-11-/t18-,19-/m0/s1 |
| InChIKey | RLHRJKOISZDLHF-ZUKORNFRSA-N |
| XLogP | 4.89 |
| TPSA | 21.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|