C26H42O2 — CID 57274536
[(1R,2R,6S)-2-methoxy-3,3-dimethyl-6-non-1-enylcyclohexyl]methoxymethylbenzene (PubChem CID 57274536) has the molecular formula C26H42O2 and a molecular weight of 386.62 g/mol. Its IUPAC name is [(1R,2R,6S)-2-methoxy-3,3-dimethyl-6-non-1-enylcyclohexyl]methoxymethylbenzene.
| Compound Name | [(1R,2R,6S)-2-methoxy-3,3-dimethyl-6-non-1-enylcyclohexyl]methoxymethylbenzene |
|---|---|
| PubChem CID | 57274536 |
| Molecular Formula | C26H42O2 |
| Molecular Weight | 386.62 g/mol |
| Exact Mass | 386.32 |
| IUPAC Name | [(1R,2R,6S)-2-methoxy-3,3-dimethyl-6-non-1-enylcyclohexyl]methoxymethylbenzene |
| SMILES | CCCCCCCC=CC1CCC(C)(C)[C@H](OC)[C@H]1COCc1ccccc1 |
| InChI | InChI=1S/C26H42O2/c1-5-6-7-8-9-10-14-17-23-18-19-26(2,3)25(27-4)24(23)21-28-20-22-15-12-11-13-16-22/h11-17,23-25H,5-10,18-21H2,1-4H3/t23?,24-,25+/m0/s1 |
| InChIKey | RFFXIXCMCRFALI-NCPLZGKYSA-N |
| XLogP | 7.19 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.62 |
| LogP ≤ 5 | 7.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|