C23H34O2 — CID 72704281
trans-(1S,2R)-2-[(Z)-hept-1-enyl]-1-[(E)-3-phenylmethoxyprop-1-enyl]cyclohexan-1-ol (PubChem CID 72704281) has the molecular formula C23H34O2 and a molecular weight of 342.52 g/mol. Its IUPAC name is trans-(1S,2R)-2-[(Z)-hept-1-enyl]-1-[(E)-3-phenylmethoxyprop-1-enyl]cyclohexan-1-ol.
| Compound Name | trans-(1S,2R)-2-[(Z)-hept-1-enyl]-1-[(E)-3-phenylmethoxyprop-1-enyl]cyclohexan-1-ol |
|---|---|
| PubChem CID | 72704281 |
| Molecular Formula | C23H34O2 |
| Molecular Weight | 342.52 g/mol |
| Exact Mass | 342.26 |
| IUPAC Name | trans-(1S,2R)-2-[(Z)-hept-1-enyl]-1-[(E)-3-phenylmethoxyprop-1-enyl]cyclohexan-1-ol |
| SMILES | CCCCC/C=C\[C@H]1CCCC[C@]1(O)/C=C/COCc1ccccc1 |
| InChI | InChI=1S/C23H34O2/c1-2-3-4-5-9-15-22-16-10-11-17-23(22,24)18-12-19-25-20-21-13-7-6-8-14-21/h6-9,12-15,18,22,24H,2-5,10-11,16-17,19-20H2,1H3/b15-9-,18-12+/t22-,23-/m0/s1 |
| InChIKey | VOCVPEDMZALSTQ-SUUKFTGNSA-N |
| XLogP | 5.82 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.52 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|