C21H30O4 — CID 102017219
trans-ethyl (1S,2S)-2-hydroxy-1-[(E)-6-phenylmethoxyhex-4-enyl]cyclopentane-1-carboxylate (PubChem CID 102017219) has the molecular formula C21H30O4 and a molecular weight of 346.47 g/mol. Its IUPAC name is trans-ethyl (1S,2S)-2-hydroxy-1-[(E)-6-phenylmethoxyhex-4-enyl]cyclopentane-1-carboxylate.
| Compound Name | trans-ethyl (1S,2S)-2-hydroxy-1-[(E)-6-phenylmethoxyhex-4-enyl]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 102017219 |
| Molecular Formula | C21H30O4 |
| Molecular Weight | 346.47 g/mol |
| Exact Mass | 346.21 |
| IUPAC Name | trans-ethyl (1S,2S)-2-hydroxy-1-[(E)-6-phenylmethoxyhex-4-enyl]cyclopentane-1-carboxylate |
| SMILES | CCOC(=O)[C@@]1(CCC/C=C/COCc2ccccc2)CCC[C@@H]1O |
| InChI | InChI=1S/C21H30O4/c1-2-25-20(23)21(15-10-13-19(21)22)14-8-3-4-9-16-24-17-18-11-6-5-7-12-18/h4-7,9,11-12,19,22H,2-3,8,10,13-17H2,1H3/b9-4+/t19-,21-/m0/s1 |
| InChIKey | LYZWTDNDHKFPJK-VMSUNOLGSA-N |
| XLogP | 4.02 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.47 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|