C20H30O3 — CID 141100848
2-methylpropyl 2-phenylmethoxy-1-propylcyclopentane-1-carboxylate (PubChem CID 141100848) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is 2-methylpropyl 2-phenylmethoxy-1-propylcyclopentane-1-carboxylate.
| Compound Name | 2-methylpropyl 2-phenylmethoxy-1-propylcyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 141100848 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 2-methylpropyl 2-phenylmethoxy-1-propylcyclopentane-1-carboxylate |
| SMILES | CCCC1(C(=O)OCC(C)C)CCCC1OCc1ccccc1 |
| InChI | InChI=1S/C20H30O3/c1-4-12-20(19(21)23-14-16(2)3)13-8-11-18(20)22-15-17-9-6-5-7-10-17/h5-7,9-10,16,18H,4,8,11-15H2,1-3H3 |
| InChIKey | VPWYJPKNSQBUAB-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |