C22H32O3 — CID 141100936
2-methylpropyl 1-cyclopentyl-2-phenylmethoxycyclopentane-1-carboxylate (PubChem CID 141100936) has the molecular formula C22H32O3 and a molecular weight of 344.49 g/mol. Its IUPAC name is 2-methylpropyl 1-cyclopentyl-2-phenylmethoxycyclopentane-1-carboxylate.
| Compound Name | 2-methylpropyl 1-cyclopentyl-2-phenylmethoxycyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 141100936 |
| Molecular Formula | C22H32O3 |
| Molecular Weight | 344.49 g/mol |
| Exact Mass | 344.24 |
| IUPAC Name | 2-methylpropyl 1-cyclopentyl-2-phenylmethoxycyclopentane-1-carboxylate |
| SMILES | CC(C)COC(=O)C1(C2CCCC2)CCCC1OCc1ccccc1 |
| InChI | InChI=1S/C22H32O3/c1-17(2)15-25-21(23)22(19-11-6-7-12-19)14-8-13-20(22)24-16-18-9-4-3-5-10-18/h3-5,9-10,17,19-20H,6-8,11-16H2,1-2H3 |
| InChIKey | ONQGLQJPJLSOSY-UHFFFAOYSA-N |
| XLogP | 5.13 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.49 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |