C23H34O3 — CID 141100914
2-methylpropyl 1-cyclopentyl-2-[(4-methylphenyl)methoxy]cyclopentane-1-carboxylate (PubChem CID 141100914) has the molecular formula C23H34O3 and a molecular weight of 358.52 g/mol. Its IUPAC name is 2-methylpropyl 1-cyclopentyl-2-[(4-methylphenyl)methoxy]cyclopentane-1-carboxylate.
| Compound Name | 2-methylpropyl 1-cyclopentyl-2-[(4-methylphenyl)methoxy]cyclopentane-1-carboxylate |
|---|---|
| PubChem CID | 141100914 |
| Molecular Formula | C23H34O3 |
| Molecular Weight | 358.52 g/mol |
| Exact Mass | 358.25 |
| IUPAC Name | 2-methylpropyl 1-cyclopentyl-2-[(4-methylphenyl)methoxy]cyclopentane-1-carboxylate |
| SMILES | Cc1ccc(COC2CCCC2(C(=O)OCC(C)C)C2CCCC2)cc1 |
| InChI | InChI=1S/C23H34O3/c1-17(2)15-26-22(24)23(20-7-4-5-8-20)14-6-9-21(23)25-16-19-12-10-18(3)11-13-19/h10-13,17,20-21H,4-9,14-16H2,1-3H3 |
| InChIKey | VNXCHKNOGAXPAJ-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.52 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |