C23H34O4 — CID 69200542
[2-(2-methylpropoxycarbonyl)-2-pentylcyclopentyl] 3-methylbenzoate (PubChem CID 69200542) has the molecular formula C23H34O4 and a molecular weight of 374.52 g/mol. Its IUPAC name is [2-(2-methylpropoxycarbonyl)-2-pentylcyclopentyl] 3-methylbenzoate.
| Compound Name | [2-(2-methylpropoxycarbonyl)-2-pentylcyclopentyl] 3-methylbenzoate |
|---|---|
| PubChem CID | 69200542 |
| Molecular Formula | C23H34O4 |
| Molecular Weight | 374.52 g/mol |
| Exact Mass | 374.25 |
| IUPAC Name | [2-(2-methylpropoxycarbonyl)-2-pentylcyclopentyl] 3-methylbenzoate |
| SMILES | CCCCCC1(C(=O)OCC(C)C)CCCC1OC(=O)c1cccc(C)c1 |
| InChI | InChI=1S/C23H34O4/c1-5-6-7-13-23(22(25)26-16-17(2)3)14-9-12-20(23)27-21(24)19-11-8-10-18(4)15-19/h8,10-11,15,17,20H,5-7,9,12-14,16H2,1-4H3 |
| InChIKey | WNXAYJNQRAVCLK-UHFFFAOYSA-N |
| XLogP | 5.47 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.52 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|