C22H24O4 — CID 69199999
[2-methoxycarbonyl-2-(2-phenylethyl)cyclopentyl] benzoate (PubChem CID 69199999) has the molecular formula C22H24O4 and a molecular weight of 352.43 g/mol. Its IUPAC name is [2-methoxycarbonyl-2-(2-phenylethyl)cyclopentyl] benzoate.
| Compound Name | [2-methoxycarbonyl-2-(2-phenylethyl)cyclopentyl] benzoate |
|---|---|
| PubChem CID | 69199999 |
| Molecular Formula | C22H24O4 |
| Molecular Weight | 352.43 g/mol |
| Exact Mass | 352.17 |
| IUPAC Name | [2-methoxycarbonyl-2-(2-phenylethyl)cyclopentyl] benzoate |
| SMILES | COC(=O)C1(CCc2ccccc2)CCCC1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C22H24O4/c1-25-21(24)22(16-14-17-9-4-2-5-10-17)15-8-13-19(22)26-20(23)18-11-6-3-7-12-18/h2-7,9-12,19H,8,13-16H2,1H3 |
| InChIKey | SNOWXZNWGGHWGQ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.43 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |