C18H22O3 — CID 11403441
[(1aR,4aS,5R,8aS)-4a-methyl-1a,2,3,4,5,6,7,8-octahydronaphtho[4a,5-b]oxiren-5-yl] benzoate (PubChem CID 11403441) has the molecular formula C18H22O3 and a molecular weight of 286.37 g/mol. Its IUPAC name is [(1aR,4aS,5R,8aS)-4a-methyl-1a,2,3,4,5,6,7,8-octahydronaphtho[4a,5-b]oxiren-5-yl] benzoate.
| Compound Name | [(1aR,4aS,5R,8aS)-4a-methyl-1a,2,3,4,5,6,7,8-octahydronaphtho[4a,5-b]oxiren-5-yl] benzoate |
|---|---|
| PubChem CID | 11403441 |
| Molecular Formula | C18H22O3 |
| Molecular Weight | 286.37 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | [(1aR,4aS,5R,8aS)-4a-methyl-1a,2,3,4,5,6,7,8-octahydronaphtho[4a,5-b]oxiren-5-yl] benzoate |
| SMILES | C[C@@]12CCC[C@H]3O[C@]31CCC[C@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H22O3/c1-17-11-5-10-15-18(17,21-15)12-6-9-14(17)20-16(19)13-7-3-2-4-8-13/h2-4,7-8,14-15H,5-6,9-12H2,1H3/t14-,15-,17+,18-/m1/s1 |
| InChIKey | HJHLNAWKPIIEMS-XYVMCAHJSA-N |
| XLogP | 3.72 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|