C14H16O6 — CID 167652207
[(3S,4R,6R,7S)-6,7,8-trihydroxy-5-oxaspiro[3.4]octan-3-yl] benzoate (PubChem CID 167652207) has the molecular formula C14H16O6 and a molecular weight of 280.28 g/mol. Its IUPAC name is [(3S,4R,6R,7S)-6,7,8-trihydroxy-5-oxaspiro[3.4]octan-3-yl] benzoate.
| Compound Name | [(3S,4R,6R,7S)-6,7,8-trihydroxy-5-oxaspiro[3.4]octan-3-yl] benzoate |
|---|---|
| PubChem CID | 167652207 |
| Molecular Formula | C14H16O6 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | [(3S,4R,6R,7S)-6,7,8-trihydroxy-5-oxaspiro[3.4]octan-3-yl] benzoate |
| SMILES | O=C(O[C@H]1CC[C@]12O[C@@H](O)[C@@H](O)C2O)c1ccccc1 |
| InChI | InChI=1S/C14H16O6/c15-10-11(16)14(20-13(10)18)7-6-9(14)19-12(17)8-4-2-1-3-5-8/h1-5,9-11,13,15-16,18H,6-7H2/t9-,10-,11?,13+,14-/m0/s1 |
| InChIKey | GHTGKRBMMRSVEG-GWNSKXJYSA-N |
| XLogP | -0.19 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |