C18H22O6 — CID 164935244
[(1'R,3aR,4S)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-yl] benzoate (PubChem CID 164935244) has the molecular formula C18H22O6 and a molecular weight of 334.37 g/mol. Its IUPAC name is [(1'R,3aR,4S)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-yl] benzoate.
| Compound Name | [(1'R,3aR,4S)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-yl] benzoate |
|---|---|
| PubChem CID | 164935244 |
| Molecular Formula | C18H22O6 |
| Molecular Weight | 334.37 g/mol |
| Exact Mass | 334.14 |
| IUPAC Name | [(1'R,3aR,4S)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-yl] benzoate |
| SMILES | COC1O[C@]2(CC[C@H]2OC(=O)c2ccccc2)[C@@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C18H22O6/c1-17(2)22-13-14(23-17)18(24-16(13)20-3)10-9-12(18)21-15(19)11-7-5-4-6-8-11/h4-8,12-14,16H,9-10H2,1-3H3/t12-,13?,14-,16?,18+/m1/s1 |
| InChIKey | JXYHHOHLIHMNBQ-ORGVUMEKSA-N |
| XLogP | 2.27 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.37 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |