C17H20O6 — CID 174024004
[(1'R,4R,6R)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-yl] benzoate (PubChem CID 174024004) has the molecular formula C17H20O6 and a molecular weight of 320.34 g/mol. Its IUPAC name is [(1'R,4R,6R)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-yl] benzoate.
| Compound Name | [(1'R,4R,6R)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-yl] benzoate |
|---|---|
| PubChem CID | 174024004 |
| Molecular Formula | C17H20O6 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.13 |
| IUPAC Name | [(1'R,4R,6R)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-yl] benzoate |
| SMILES | CO[C@@H]1O[C@@]2(C[C@H]2OC(=O)c2ccccc2)C2OC(C)(C)OC21 |
| InChI | InChI=1S/C17H20O6/c1-16(2)21-12-13(22-16)17(23-15(12)19-3)9-11(17)20-14(18)10-7-5-4-6-8-10/h4-8,11-13,15H,9H2,1-3H3/t11-,12?,13?,15-,17-/m1/s1 |
| InChIKey | FLRSGOSYRQEFTN-VUZVAXIHSA-N |
| XLogP | 1.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |