C10H16O5 — CID 167191478
(1'S,4S)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-ol (PubChem CID 167191478) has the molecular formula C10H16O5 and a molecular weight of 216.23 g/mol. Its IUPAC name is (1'S,4S)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-ol.
| Compound Name | (1'S,4S)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-ol |
|---|---|
| PubChem CID | 167191478 |
| Molecular Formula | C10H16O5 |
| Molecular Weight | 216.23 g/mol |
| Exact Mass | 216.10 |
| IUPAC Name | (1'S,4S)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-ol |
| SMILES | COC1O[C@]2(C[C@@H]2O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C10H16O5/c1-9(2)13-6-7(14-9)10(4-5(10)11)15-8(6)12-3/h5-8,11H,4H2,1-3H3/t5-,6?,7?,8?,10-/m0/s1 |
| InChIKey | FMMGAUVOFBEUMP-VPYJBUCWSA-N |
| XLogP | 0.01 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.23 |
| LogP ≤ 5 | 0.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |