C12H20O5 — CID 164935078
[(1'S,4R,6aS)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-yl]methanol (PubChem CID 164935078) has the molecular formula C12H20O5 and a molecular weight of 244.29 g/mol. Its IUPAC name is [(1'S,4R,6aS)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-yl]methanol.
| Compound Name | [(1'S,4R,6aS)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-yl]methanol |
|---|---|
| PubChem CID | 164935078 |
| Molecular Formula | C12H20O5 |
| Molecular Weight | 244.29 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | [(1'S,4R,6aS)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-yl]methanol |
| SMILES | COC1O[C@@]2(CC[C@H]2CO)C2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C12H20O5/c1-11(2)15-8-9(16-11)12(17-10(8)14-3)5-4-7(12)6-13/h7-10,13H,4-6H2,1-3H3/t7-,8-,9?,10?,12+/m0/s1 |
| InChIKey | CHVJEWVRUGCKJN-CWKWDKQRSA-N |
| XLogP | 0.65 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.29 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |