C10H14Br2O4 — CID 164935204
(3aR,4R)-1',1'-dibromo-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane] (PubChem CID 164935204) has the molecular formula C10H14Br2O4 and a molecular weight of 358.03 g/mol. Its IUPAC name is (3aR,4R)-1',1'-dibromo-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane].
| Compound Name | (3aR,4R)-1',1'-dibromo-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane] |
|---|---|
| PubChem CID | 164935204 |
| Molecular Formula | C10H14Br2O4 |
| Molecular Weight | 358.03 g/mol |
| Exact Mass | 355.93 |
| IUPAC Name | (3aR,4R)-1',1'-dibromo-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane] |
| SMILES | COC1O[C@]2(CC2(Br)Br)[C@@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C10H14Br2O4/c1-8(2)14-5-6(15-8)9(4-10(9,11)12)16-7(5)13-3/h5-7H,4H2,1-3H3/t5?,6-,7?,9-/m1/s1 |
| InChIKey | CFFBKHCDUXQDDU-MFWQPVBSSA-N |
| XLogP | 2.14 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.03 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|