C11H15ClO5 — CID 163577047
(2'S,3aS,4S,6R,6aR)-2'-chloro-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,3'-cyclobutane]-1'-one (PubChem CID 163577047) has the molecular formula C11H15ClO5 and a molecular weight of 262.69 g/mol. Its IUPAC name is (2'S,3aS,4S,6R,6aR)-2'-chloro-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,3'-cyclobutane]-1'-one.
| Compound Name | (2'S,3aS,4S,6R,6aR)-2'-chloro-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,3'-cyclobutane]-1'-one |
|---|---|
| PubChem CID | 163577047 |
| Molecular Formula | C11H15ClO5 |
| Molecular Weight | 262.69 g/mol |
| Exact Mass | 262.06 |
| IUPAC Name | (2'S,3aS,4S,6R,6aR)-2'-chloro-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,3'-cyclobutane]-1'-one |
| SMILES | CO[C@@H]1O[C@@]2(CC(=O)[C@H]2Cl)[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C11H15ClO5/c1-10(2)15-6-8(16-10)11(17-9(6)14-3)4-5(13)7(11)12/h6-9H,4H2,1-3H3/t6-,7-,8+,9-,11-/m1/s1 |
| InChIKey | GEJTWRSKVCRVCX-ZBGLXGBJSA-N |
| XLogP | 0.83 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.69 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|