C11H18O5 — CID 164935294
(1'R,4S,6aS)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-ol (PubChem CID 164935294) has the molecular formula C11H18O5 and a molecular weight of 230.26 g/mol. Its IUPAC name is (1'R,4S,6aS)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-ol.
| Compound Name | (1'R,4S,6aS)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-ol |
|---|---|
| PubChem CID | 164935294 |
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.26 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (1'R,4S,6aS)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclobutane]-1'-ol |
| SMILES | COC1O[C@]2(CC[C@H]2O)C2OC(C)(C)O[C@H]12 |
| InChI | InChI=1S/C11H18O5/c1-10(2)14-7-8(15-10)11(5-4-6(11)12)16-9(7)13-3/h6-9,12H,4-5H2,1-3H3/t6-,7+,8?,9?,11+/m1/s1 |
| InChIKey | CXKUZJJGKJYEED-AAOXENBPSA-N |
| XLogP | 0.40 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.26 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |