C11H16Cl2O5 — CID 167565102
(3aR,4S,6R)-2',2'-dichloro-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,3'-cyclobutane]-1'-ol (PubChem CID 167565102) has the molecular formula C11H16Cl2O5 and a molecular weight of 299.15 g/mol. Its IUPAC name is (3aR,4S,6R)-2',2'-dichloro-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,3'-cyclobutane]-1'-ol.
| Compound Name | (3aR,4S,6R)-2',2'-dichloro-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,3'-cyclobutane]-1'-ol |
|---|---|
| PubChem CID | 167565102 |
| Molecular Formula | C11H16Cl2O5 |
| Molecular Weight | 299.15 g/mol |
| Exact Mass | 298.04 |
| IUPAC Name | (3aR,4S,6R)-2',2'-dichloro-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,3'-cyclobutane]-1'-ol |
| SMILES | CO[C@@H]1O[C@@]2(CC(O)C2(Cl)Cl)[C@@H]2OC(C)(C)OC12 |
| InChI | InChI=1S/C11H16Cl2O5/c1-9(2)16-6-7(17-9)10(18-8(6)15-3)4-5(14)11(10,12)13/h5-8,14H,4H2,1-3H3/t5?,6?,7-,8-,10+/m1/s1 |
| InChIKey | OBXQVEAUDJRSOX-KDMMQHKWSA-N |
| XLogP | 1.19 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.15 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|