C11H16O5S — CID 167192068
(4S)-6-methoxy-2,2,4'-trimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-thietane]-3'-one (PubChem CID 167192068) has the molecular formula C11H16O5S and a molecular weight of 260.31 g/mol. Its IUPAC name is (4S)-6-methoxy-2,2,4'-trimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-thietane]-3'-one.
| Compound Name | (4S)-6-methoxy-2,2,4'-trimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-thietane]-3'-one |
|---|---|
| PubChem CID | 167192068 |
| Molecular Formula | C11H16O5S |
| Molecular Weight | 260.31 g/mol |
| Exact Mass | 260.07 |
| IUPAC Name | (4S)-6-methoxy-2,2,4'-trimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-thietane]-3'-one |
| SMILES | COC1O[C@]2(SC(C)C2=O)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C11H16O5S/c1-5-7(12)11(17-5)8-6(9(13-4)16-11)14-10(2,3)15-8/h5-6,8-9H,1-4H3/t5?,6?,8?,9?,11-/m1/s1 |
| InChIKey | QXNXFRJNQKQMCL-PAPMHXRCSA-N |
| XLogP | 0.91 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.31 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |