C16H19BO6 — CID 174023994
2-[(1'S,4S)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-yl]-1,3,2-benzodioxaborole (PubChem CID 174023994) has the molecular formula C16H19BO6 and a molecular weight of 318.13 g/mol. Its IUPAC name is 2-[(1'S,4S)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-yl]-1,3,2-benzodioxaborole.
| Compound Name | 2-[(1'S,4S)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-yl]-1,3,2-benzodioxaborole |
|---|---|
| PubChem CID | 174023994 |
| Molecular Formula | C16H19BO6 |
| Molecular Weight | 318.13 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | 2-[(1'S,4S)-6-methoxy-2,2-dimethylspiro[6,6a-dihydro-3aH-furo[3,4-d][1,3]dioxole-4,2'-cyclopropane]-1'-yl]-1,3,2-benzodioxaborole |
| SMILES | COC1O[C@]2(C[C@@H]2B2Oc3ccccc3O2)C2OC(C)(C)OC12 |
| InChI | InChI=1S/C16H19BO6/c1-15(2)19-12-13(20-15)16(21-14(12)18-3)8-11(16)17-22-9-6-4-5-7-10(9)23-17/h4-7,11-14H,8H2,1-3H3/t11-,12?,13?,14?,16-/m0/s1 |
| InChIKey | XCXDOKCGJUCFPA-QTNGLCDKSA-N |
| XLogP | 1.98 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.13 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|