C18H20O3 — CID 23250504
[(1R,8aR)-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-1-yl] benzoate (PubChem CID 23250504) has the molecular formula C18H20O3 and a molecular weight of 284.35 g/mol. Its IUPAC name is [(1R,8aR)-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-1-yl] benzoate.
| Compound Name | [(1R,8aR)-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-1-yl] benzoate |
|---|---|
| PubChem CID | 23250504 |
| Molecular Formula | C18H20O3 |
| Molecular Weight | 284.35 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | [(1R,8aR)-8a-methyl-6-oxo-1,2,3,4,7,8-hexahydronaphthalen-1-yl] benzoate |
| SMILES | C[C@@]12CCC(=O)C=C1CCC[C@H]2OC(=O)c1ccccc1 |
| InChI | InChI=1S/C18H20O3/c1-18-11-10-15(19)12-14(18)8-5-9-16(18)21-17(20)13-6-3-2-4-7-13/h2-4,6-7,12,16H,5,8-11H2,1H3/t16-,18-/m1/s1 |
| InChIKey | NJTXJDYZPQNTSM-SJLPKXTDSA-N |
| XLogP | 3.69 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.35 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |