C26H34NO3+ — CID 13473438
[(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 1-methylpyridin-1-ium-3-carboxylate (PubChem CID 13473438) has the molecular formula C26H34NO3+ and a molecular weight of 408.56 g/mol. Its IUPAC name is [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 1-methylpyridin-1-ium-3-carboxylate.
| Compound Name | [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 1-methylpyridin-1-ium-3-carboxylate |
|---|---|
| PubChem CID | 13473438 |
| Molecular Formula | C26H34NO3+ |
| Molecular Weight | 408.56 g/mol |
| Exact Mass | 408.25 |
| IUPAC Name | [(8R,9S,10R,13S,14S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl] 1-methylpyridin-1-ium-3-carboxylate |
| SMILES | C[n+]1cccc(C(=O)O[C@H]2CC[C@H]3[C@@H]4CCC5=CC(=O)CC[C@]5(C)[C@H]4CC[C@]23C)c1 |
| InChI | InChI=1S/C26H34NO3/c1-25-12-10-19(28)15-18(25)6-7-20-21-8-9-23(26(21,2)13-11-22(20)25)30-24(29)17-5-4-14-27(3)16-17/h4-5,14-16,20-23H,6-13H2,1-3H3/q+1/t20-,21-,22-,23-,25-,26-/m0/s1 |
| InChIKey | QXLUYGZVZVUVRF-IXKNJLPQSA-N |
| XLogP | 4.57 |
| TPSA | 47.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.56 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|