C26H35NO6S — CID 173200207
azane;2-[[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxycarbonyl]benzenesulfonic acid (PubChem CID 173200207) has the molecular formula C26H35NO6S and a molecular weight of 489.63 g/mol. Its IUPAC name is azane;2-[[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxycarbonyl]benzenesulfonic acid.
| Compound Name | azane;2-[[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxycarbonyl]benzenesulfonic acid |
|---|---|
| PubChem CID | 173200207 |
| Molecular Formula | C26H35NO6S |
| Molecular Weight | 489.63 g/mol |
| Exact Mass | 489.22 |
| IUPAC Name | azane;2-[[(10R,13S,17S)-10,13-dimethyl-3-oxo-1,2,6,7,8,9,11,12,14,15,16,17-dodecahydrocyclopenta[a]phenanthren-17-yl]oxycarbonyl]benzenesulfonic acid |
| SMILES | C[C@]12CCC(=O)C=C1CCC1C2CC[C@@]2(C)C1CC[C@@H]2OC(=O)c1ccccc1S(=O)(=O)O.N |
| InChI | InChI=1S/C26H32O6S.H3N/c1-25-13-11-17(27)15-16(25)7-8-18-20-9-10-23(26(20,2)14-12-21(18)25)32-24(28)19-5-3-4-6-22(19)33(29,30)31;/h3-6,15,18,20-21,23H,7-14H2,1-2H3,(H,29,30,31);1H3/t18?,20?,21?,23-,25-,26-;/m0./s1 |
| InChIKey | KJNSBYJLRCXXPL-KATUJAPBSA-N |
| XLogP | 5.15 |
| TPSA | 132.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 489.63 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|