C19H22O3 — CID 10542098
(6-hydroxy-5,8a-dimethyl-2,3,4,6-tetrahydro-1H-naphthalen-1-yl) benzoate (PubChem CID 10542098) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (6-hydroxy-5,8a-dimethyl-2,3,4,6-tetrahydro-1H-naphthalen-1-yl) benzoate.
| Compound Name | (6-hydroxy-5,8a-dimethyl-2,3,4,6-tetrahydro-1H-naphthalen-1-yl) benzoate |
|---|---|
| PubChem CID | 10542098 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (6-hydroxy-5,8a-dimethyl-2,3,4,6-tetrahydro-1H-naphthalen-1-yl) benzoate |
| SMILES | CC1=C2CCCC(OC(=O)c3ccccc3)C2(C)C=CC1O |
| InChI | InChI=1S/C19H22O3/c1-13-15-9-6-10-17(19(15,2)12-11-16(13)20)22-18(21)14-7-4-3-5-8-14/h3-5,7-8,11-12,16-17,20H,6,9-10H2,1-2H3 |
| InChIKey | VYDYIKUYTGJKPV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|