C19H22O3 — CID 10685492
(4,8a-dimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl) benzoate (PubChem CID 10685492) has the molecular formula C19H22O3 and a molecular weight of 298.38 g/mol. Its IUPAC name is (4,8a-dimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl) benzoate.
| Compound Name | (4,8a-dimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl) benzoate |
|---|---|
| PubChem CID | 10685492 |
| Molecular Formula | C19H22O3 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.16 |
| IUPAC Name | (4,8a-dimethyl-3-oxo-1,2,5,6,7,8-hexahydronaphthalen-2-yl) benzoate |
| SMILES | CC1=C2CCCCC2(C)CC(OC(=O)c2ccccc2)C1=O |
| InChI | InChI=1S/C19H22O3/c1-13-15-10-6-7-11-19(15,2)12-16(17(13)20)22-18(21)14-8-4-3-5-9-14/h3-5,8-9,16H,6-7,10-12H2,1-2H3 |
| InChIKey | KHEQYNJYHCOUPS-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |