C22H30O3 — CID 46886847
[(1R,2Z,4S)-4-hydroxy-2,5,5,9-tetramethylcycloundeca-2,9-dien-1-yl] benzoate (PubChem CID 46886847) has the molecular formula C22H30O3 and a molecular weight of 342.48 g/mol. Its IUPAC name is [(1R,2Z,4S)-4-hydroxy-2,5,5,9-tetramethylcycloundeca-2,9-dien-1-yl] benzoate.
| Compound Name | [(1R,2Z,4S)-4-hydroxy-2,5,5,9-tetramethylcycloundeca-2,9-dien-1-yl] benzoate |
|---|---|
| PubChem CID | 46886847 |
| Molecular Formula | C22H30O3 |
| Molecular Weight | 342.48 g/mol |
| Exact Mass | 342.22 |
| IUPAC Name | [(1R,2Z,4S)-4-hydroxy-2,5,5,9-tetramethylcycloundeca-2,9-dien-1-yl] benzoate |
| SMILES | CC1=CC[C@@H](OC(=O)c2ccccc2)/C(C)=C\[C@H](O)C(C)(C)CCC1 |
| InChI | InChI=1S/C22H30O3/c1-16-9-8-14-22(3,4)20(23)15-17(2)19(13-12-16)25-21(24)18-10-6-5-7-11-18/h5-7,10-12,15,19-20,23H,8-9,13-14H2,1-4H3/b16-12?,17-15-/t19-,20+/m1/s1 |
| InChIKey | JRSLQKPYZJDQRG-YXPSBTKLSA-N |
| XLogP | 5.07 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.48 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|