C20H32O3 — CID 177467374
[(2Z,4R,9E)-4-hydroxy-2,5,5,9-tetramethylcycloundeca-2,9-dien-1-yl] (Z)-2-methylbut-2-enoate (PubChem CID 177467374) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is [(2Z,4R,9E)-4-hydroxy-2,5,5,9-tetramethylcycloundeca-2,9-dien-1-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(2Z,4R,9E)-4-hydroxy-2,5,5,9-tetramethylcycloundeca-2,9-dien-1-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 177467374 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | [(2Z,4R,9E)-4-hydroxy-2,5,5,9-tetramethylcycloundeca-2,9-dien-1-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)OC1C/C=C(\C)CCCC(C)(C)[C@H](O)/C=C\1C |
| InChI | InChI=1S/C20H32O3/c1-7-15(3)19(22)23-17-11-10-14(2)9-8-12-20(5,6)18(21)13-16(17)4/h7,10,13,17-18,21H,8-9,11-12H2,1-6H3/b14-10+,15-7-,16-13-/t17?,18-/m1/s1 |
| InChIKey | PEHOVSYWKFYAKR-WTDTYNHESA-N |
| XLogP | 4.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|