C20H32O3 — CID 162847758
[(1R,2E,4S,6E)-4-hydroxy-3,7,11,11-tetramethylcycloundeca-2,6-dien-1-yl] (E)-2-methylbut-2-enoate (PubChem CID 162847758) has the molecular formula C20H32O3 and a molecular weight of 320.47 g/mol. Its IUPAC name is [(1R,2E,4S,6E)-4-hydroxy-3,7,11,11-tetramethylcycloundeca-2,6-dien-1-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(1R,2E,4S,6E)-4-hydroxy-3,7,11,11-tetramethylcycloundeca-2,6-dien-1-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162847758 |
| Molecular Formula | C20H32O3 |
| Molecular Weight | 320.47 g/mol |
| Exact Mass | 320.24 |
| IUPAC Name | [(1R,2E,4S,6E)-4-hydroxy-3,7,11,11-tetramethylcycloundeca-2,6-dien-1-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)O[C@@H]1/C=C(\C)[C@@H](O)C/C=C(\C)CCCC1(C)C |
| InChI | InChI=1S/C20H32O3/c1-7-15(3)19(22)23-18-13-16(4)17(21)11-10-14(2)9-8-12-20(18,5)6/h7,10,13,17-18,21H,8-9,11-12H2,1-6H3/b14-10+,15-7+,16-13+/t17-,18+/m0/s1 |
| InChIKey | VNKIHXUIEBJFOC-NBNWQDEMSA-N |
| XLogP | 4.72 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.47 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|