C25H32O8 — CID 162848252
[(3aR,4R,6E,9R,10Z,11aS)-9-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (E)-4-hydroxy-2-[[(E)-2-methylbut-2-enoyl]oxymethyl]but-2-enoate (PubChem CID 162848252) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is [(3aR,4R,6E,9R,10Z,11aS)-9-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (E)-4-hydroxy-2-[[(E)-2-methylbut-2-enoyl]oxymethyl]but-2-enoate.
| Compound Name | [(3aR,4R,6E,9R,10Z,11aS)-9-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (E)-4-hydroxy-2-[[(E)-2-methylbut-2-enoyl]oxymethyl]but-2-enoate |
|---|---|
| PubChem CID | 162848252 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | [(3aR,4R,6E,9R,10Z,11aS)-9-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] (E)-4-hydroxy-2-[[(E)-2-methylbut-2-enoyl]oxymethyl]but-2-enoate |
| SMILES | C=C1C(=O)O[C@H]2/C=C(/C)[C@H](O)C/C=C(/C)C[C@@H](OC(=O)/C(=C/CO)COC(=O)/C(C)=C/C)[C@@H]12 |
| InChI | InChI=1S/C25H32O8/c1-6-15(3)23(28)31-13-18(9-10-26)25(30)33-20-11-14(2)7-8-19(27)16(4)12-21-22(20)17(5)24(29)32-21/h6-7,9,12,19-22,26-27H,5,8,10-11,13H2,1-4H3/b14-7-,15-6+,16-12-,18-9+/t19-,20-,21+,22-/m1/s1 |
| InChIKey | VEAVSPLATVUSHF-RZFRKCBGSA-N |
| XLogP | 2.47 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|