C25H32O8 — CID 162891576
(6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl) 4-hydroxy-2-[(4-hydroxy-2-methylidenebutanoyl)oxymethyl]but-2-enoate (PubChem CID 162891576) has the molecular formula C25H32O8 and a molecular weight of 460.52 g/mol. Its IUPAC name is (6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl) 4-hydroxy-2-[(4-hydroxy-2-methylidenebutanoyl)oxymethyl]but-2-enoate.
| Compound Name | (6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl) 4-hydroxy-2-[(4-hydroxy-2-methylidenebutanoyl)oxymethyl]but-2-enoate |
|---|---|
| PubChem CID | 162891576 |
| Molecular Formula | C25H32O8 |
| Molecular Weight | 460.52 g/mol |
| Exact Mass | 460.21 |
| IUPAC Name | (6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl) 4-hydroxy-2-[(4-hydroxy-2-methylidenebutanoyl)oxymethyl]but-2-enoate |
| SMILES | C=C(CCO)C(=O)OCC(=CCO)C(=O)OC1CC(C)=CCCC(C)=CC2OC(=O)C(=C)C21 |
| InChI | InChI=1S/C25H32O8/c1-15-6-5-7-16(2)13-21(22-18(4)24(29)32-20(22)12-15)33-25(30)19(9-11-27)14-31-23(28)17(3)8-10-26/h7,9,12,20-22,26-27H,3-6,8,10-11,13-14H2,1-2H3 |
| InChIKey | CITAWZKMWQJSFS-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.52 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|