C20H26O6 — CID 163088599
[6-(hydroxymethyl)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 2-(hydroxymethyl)but-2-enoate (PubChem CID 163088599) has the molecular formula C20H26O6 and a molecular weight of 362.42 g/mol. Its IUPAC name is [6-(hydroxymethyl)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 2-(hydroxymethyl)but-2-enoate.
| Compound Name | [6-(hydroxymethyl)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 2-(hydroxymethyl)but-2-enoate |
|---|---|
| PubChem CID | 163088599 |
| Molecular Formula | C20H26O6 |
| Molecular Weight | 362.42 g/mol |
| Exact Mass | 362.17 |
| IUPAC Name | [6-(hydroxymethyl)-10-methyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] 2-(hydroxymethyl)but-2-enoate |
| SMILES | C=C1C(=O)OC2C=C(C)CCC=C(CO)CC(OC(=O)C(=CC)CO)C12 |
| InChI | InChI=1S/C20H26O6/c1-4-15(11-22)20(24)26-17-9-14(10-21)7-5-6-12(2)8-16-18(17)13(3)19(23)25-16/h4,7-8,16-18,21-22H,3,5-6,9-11H2,1-2H3 |
| InChIKey | DTSKIDAIGJZSRS-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.42 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|