C17H22O6 — CID 177391174
[(3aR,6E,10E,11aR)-6,10-bis(hydroxymethyl)-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] acetate (PubChem CID 177391174) has the molecular formula C17H22O6 and a molecular weight of 322.36 g/mol. Its IUPAC name is [(3aR,6E,10E,11aR)-6,10-bis(hydroxymethyl)-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] acetate.
| Compound Name | [(3aR,6E,10E,11aR)-6,10-bis(hydroxymethyl)-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] acetate |
|---|---|
| PubChem CID | 177391174 |
| Molecular Formula | C17H22O6 |
| Molecular Weight | 322.36 g/mol |
| Exact Mass | 322.14 |
| IUPAC Name | [(3aR,6E,10E,11aR)-6,10-bis(hydroxymethyl)-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl] acetate |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(/CO)CC/C=C(/CO)CC(OC(C)=O)[C@@H]12 |
| InChI | InChI=1S/C17H22O6/c1-10-16-14(22-11(2)20)6-12(8-18)4-3-5-13(9-19)7-15(16)23-17(10)21/h4,7,14-16,18-19H,1,3,5-6,8-9H2,2H3/b12-4+,13-7+/t14?,15-,16-/m1/s1 |
| InChIKey | ZXKYODRDFWLGBW-ADOPNYOSSA-N |
| XLogP | 1.04 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.36 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|