C25H32O9 — CID 14543599
[(E)-2-[[(3aR,4R,6E,10E,11aR)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl]oxycarbonyl]-4-hydroxybut-2-enyl] 3,4-dihydroxy-2-methylidenebutanoate (PubChem CID 14543599) has the molecular formula C25H32O9 and a molecular weight of 476.52 g/mol. Its IUPAC name is [(E)-2-[[(3aR,4R,6E,10E,11aR)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl]oxycarbonyl]-4-hydroxybut-2-enyl] 3,4-dihydroxy-2-methylidenebutanoate.
| Compound Name | [(E)-2-[[(3aR,4R,6E,10E,11aR)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl]oxycarbonyl]-4-hydroxybut-2-enyl] 3,4-dihydroxy-2-methylidenebutanoate |
|---|---|
| PubChem CID | 14543599 |
| Molecular Formula | C25H32O9 |
| Molecular Weight | 476.52 g/mol |
| Exact Mass | 476.20 |
| IUPAC Name | [(E)-2-[[(3aR,4R,6E,10E,11aR)-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl]oxycarbonyl]-4-hydroxybut-2-enyl] 3,4-dihydroxy-2-methylidenebutanoate |
| SMILES | C=C(C(=O)OC/C(=C\CO)C(=O)O[C@@H]1C/C(C)=C/CC/C(C)=C/[C@H]2OC(=O)C(=C)[C@@H]21)C(O)CO |
| InChI | InChI=1S/C25H32O9/c1-14-6-5-7-15(2)11-21(22-17(4)24(30)33-20(22)10-14)34-25(31)18(8-9-26)13-32-23(29)16(3)19(28)12-27/h7-8,10,19-22,26-28H,3-6,9,11-13H2,1-2H3/b14-10+,15-7+,18-8+/t19?,20-,21-,22+/m1/s1 |
| InChIKey | YOGPJYWETDSFNM-RBGIGVDUSA-N |
| XLogP | 1.44 |
| TPSA | 139.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.52 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|