C21H26O8 — CID 162870128
(9-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl) 2-acetyloxy-4-hydroxybut-2-enoate (PubChem CID 162870128) has the molecular formula C21H26O8 and a molecular weight of 406.43 g/mol. Its IUPAC name is (9-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl) 2-acetyloxy-4-hydroxybut-2-enoate.
| Compound Name | (9-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl) 2-acetyloxy-4-hydroxybut-2-enoate |
|---|---|
| PubChem CID | 162870128 |
| Molecular Formula | C21H26O8 |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.16 |
| IUPAC Name | (9-hydroxy-6,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-4-yl) 2-acetyloxy-4-hydroxybut-2-enoate |
| SMILES | C=C1C(=O)OC2C=C(C)C(O)CC=C(C)CC(OC(=O)C(=CCO)OC(C)=O)C12 |
| InChI | InChI=1S/C21H26O8/c1-11-5-6-15(24)12(2)10-18-19(13(3)20(25)28-18)17(9-11)29-21(26)16(7-8-22)27-14(4)23/h5,7,10,15,17-19,22,24H,3,6,8-9H2,1-2,4H3 |
| InChIKey | KFCKDZJAJBJSKU-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 119.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|