C20H32O4 — CID 101288321
[(4Z)-3-hydroxy-4,7,7,11-tetramethyl-12-oxabicyclo[9.1.0]dodec-4-en-6-yl] (E)-2-methylbut-2-enoate (PubChem CID 101288321) has the molecular formula C20H32O4 and a molecular weight of 336.47 g/mol. Its IUPAC name is [(4Z)-3-hydroxy-4,7,7,11-tetramethyl-12-oxabicyclo[9.1.0]dodec-4-en-6-yl] (E)-2-methylbut-2-enoate.
| Compound Name | [(4Z)-3-hydroxy-4,7,7,11-tetramethyl-12-oxabicyclo[9.1.0]dodec-4-en-6-yl] (E)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 101288321 |
| Molecular Formula | C20H32O4 |
| Molecular Weight | 336.47 g/mol |
| Exact Mass | 336.23 |
| IUPAC Name | [(4Z)-3-hydroxy-4,7,7,11-tetramethyl-12-oxabicyclo[9.1.0]dodec-4-en-6-yl] (E)-2-methylbut-2-enoate |
| SMILES | C/C=C(\C)C(=O)OC1/C=C(/C)C(O)CC2OC2(C)CCCC1(C)C |
| InChI | InChI=1S/C20H32O4/c1-7-13(2)18(22)23-16-11-14(3)15(21)12-17-20(6,24-17)10-8-9-19(16,4)5/h7,11,15-17,21H,8-10,12H2,1-6H3/b13-7+,14-11- |
| InChIKey | WMFOMQGCFKIPLY-SWTVTYKQSA-N |
| XLogP | 3.93 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.47 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|