C20H28O4 — CID 162976284
[(1R,2S,3S,7R,8S)-1,5,8-trimethyl-13-oxo-12-oxatricyclo[6.3.2.02,7]tridec-5-en-3-yl] (Z)-2-methylbut-2-enoate (PubChem CID 162976284) has the molecular formula C20H28O4 and a molecular weight of 332.44 g/mol. Its IUPAC name is [(1R,2S,3S,7R,8S)-1,5,8-trimethyl-13-oxo-12-oxatricyclo[6.3.2.02,7]tridec-5-en-3-yl] (Z)-2-methylbut-2-enoate.
| Compound Name | [(1R,2S,3S,7R,8S)-1,5,8-trimethyl-13-oxo-12-oxatricyclo[6.3.2.02,7]tridec-5-en-3-yl] (Z)-2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162976284 |
| Molecular Formula | C20H28O4 |
| Molecular Weight | 332.44 g/mol |
| Exact Mass | 332.20 |
| IUPAC Name | [(1R,2S,3S,7R,8S)-1,5,8-trimethyl-13-oxo-12-oxatricyclo[6.3.2.02,7]tridec-5-en-3-yl] (Z)-2-methylbut-2-enoate |
| SMILES | C/C=C(/C)C(=O)O[C@H]1CC(C)=C[C@@H]2[C@@H]1[C@@]1(C)CCC[C@]2(C)C(=O)O1 |
| InChI | InChI=1S/C20H28O4/c1-6-13(3)17(21)23-15-11-12(2)10-14-16(15)20(5)9-7-8-19(14,4)18(22)24-20/h6,10,14-16H,7-9,11H2,1-5H3/b13-6-/t14-,15+,16+,19+,20-/m1/s1 |
| InChIKey | KREPOBCVKLZNPY-RHJPJSDASA-N |
| XLogP | 3.95 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|