C20H30O3 — CID 162994260
(4,7-dimethyl-1a-propan-2-yl-2,3,4,4a,5,6-hexahydronaphtho[4a,5-b]oxiren-5-yl) 2-methylbut-2-enoate (PubChem CID 162994260) has the molecular formula C20H30O3 and a molecular weight of 318.46 g/mol. Its IUPAC name is (4,7-dimethyl-1a-propan-2-yl-2,3,4,4a,5,6-hexahydronaphtho[4a,5-b]oxiren-5-yl) 2-methylbut-2-enoate.
| Compound Name | (4,7-dimethyl-1a-propan-2-yl-2,3,4,4a,5,6-hexahydronaphtho[4a,5-b]oxiren-5-yl) 2-methylbut-2-enoate |
|---|---|
| PubChem CID | 162994260 |
| Molecular Formula | C20H30O3 |
| Molecular Weight | 318.46 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | (4,7-dimethyl-1a-propan-2-yl-2,3,4,4a,5,6-hexahydronaphtho[4a,5-b]oxiren-5-yl) 2-methylbut-2-enoate |
| SMILES | CC=C(C)C(=O)OC1CC(C)=CC23OC2(C(C)C)CCC(C)C13 |
| InChI | InChI=1S/C20H30O3/c1-7-14(5)18(21)22-16-10-13(4)11-20-17(16)15(6)8-9-19(20,23-20)12(2)3/h7,11-12,15-17H,8-10H2,1-6H3 |
| InChIKey | AJAXEPRSYKWNTR-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 38.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.46 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|